EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O |
| Net Charge | 0 |
| Average Mass | 136.194 |
| Monoisotopic Mass | 136.08882 |
| SMILES | Cc1ccc(CO)cc1C |
| InChI | InChI=1S/C9H12O/c1-7-3-4-9(6-10)5-8(7)2/h3-5,10H,6H2,1-2H3 |
| InChIKey | OKGZCXPDJKKZAP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Prunus avium (ncbitaxon:42229) | - | PubMed (24444903) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethylbenzyl alcohol (CHEBI:231517) has role plant metabolite (CHEBI:76924) |
| 3,4-dimethylbenzyl alcohol (CHEBI:231517) is a aromatic primary alcohol (CHEBI:33857) |
| 3,4-dimethylbenzyl alcohol (CHEBI:231517) is a methylbenzyl alcohol (CHEBI:25281) |
| IUPAC Name |
|---|
| (3,4-dimethylphenyl)methanol |
| Synonyms | Source |
|---|---|
| 1-(hydroxymethyl)-3,4-dimethylbenzene | ChEBI |
| 3,4-dimethylbenzenemethanol | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,4-dimethylbenzyl alcohol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 34-DIMETHYLBENZYL-ALCOHOL | MetaCyc |
| C00058873 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:6966-10-5 | NIST Chemistry WebBook |
| Citations |
|---|