EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl6Sb.K |
| Net Charge | 0 |
| Average Mass | 373.576 |
| Monoisotopic Mass | 369.68064 |
| SMILES | [Cl][Sb-]([Cl])([Cl])([Cl])([Cl])[Cl].[K+] |
| InChI | InChI=1S/6ClH.K.Sb/h6*1H;;/q;;;;;;+1;+5/p-6 |
| InChIKey | QWPXFQMWSGNALL-UHFFFAOYSA-H |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Biological Role: | nutrient A nutrient is a food component that an organism uses to survive and grow. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kaliumhexachloroantimonat(V) (CHEBI:231513) has role NMR chemical shift reference compound (CHEBI:228364) |
| Kaliumhexachloroantimonat(V) (CHEBI:231513) is a inorganic potassium salt (CHEBI:190303) |