EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10Cl2Zr |
| Net Charge | 0 |
| Average Mass | 292.320 |
| Monoisotopic Mass | 289.92066 |
| SMILES | [Cl][Zr]([Cl])([CH]1C=CC=C1)[CH]1C=CC=C1 |
| InChI | InChI=1S/2C5H5.2ClH.Zr/c2*1-2-4-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | QRUYYSPCOGSZGQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Zirconocene dichloride (CHEBI:231508) has role NMR chemical shift reference compound (CHEBI:228364) |
| Zirconocene dichloride (CHEBI:231508) is a organochlorine compound (CHEBI:36683) |
| Zirconocene dichloride (CHEBI:231508) is a zirconium coordination entity (CHEBI:51001) |