EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | AsF6.Na |
| Net Charge | 0 |
| Average Mass | 211.900 |
| Monoisotopic Mass | 211.90179 |
| SMILES | F[As-](F)(F)(F)(F)F.[Na+] |
| InChI | InChI=1S/AsF6.Na/c2-1(3,4,5,6)7;/q-1;+1 |
| InChIKey | NFXMAZFYHDSPPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sodium hexafluoroarsenate (CHEBI:231507) has role NMR chemical shift reference compound (CHEBI:228364) |
| Sodium hexafluoroarsenate (CHEBI:231507) is a inorganic molecular entity (CHEBI:24835) |
| Sodium hexafluoroarsenate (CHEBI:231507) is a inorganic sodium salt (CHEBI:38702) |