EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H12Ge |
| Net Charge | 0 |
| Average Mass | 132.750 |
| Monoisotopic Mass | 134.01508 |
| SMILES | [CH3][Ge]([CH3])([CH3])[CH3] |
| InChI | InChI=1S/C4H12Ge/c1-5(2,3)4/h1-4H3 |
| InChIKey | ZRLCXMPFXYVHGS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramethylgermane (CHEBI:231506) has role NMR chemical shift reference compound (CHEBI:228364) |
| tetramethylgermane (CHEBI:231506) is a organogermanium compound (CHEBI:37169) |
| IUPAC Name |
|---|
| tetramethylgermane |
| Synonyms | Source |
|---|---|
| Ge(CH3)4 | ChEBI |
| tetramethylgermanium | NIST Chemistry WebBook |
| tetramethyl germanium | ChEBI |
| (CH3)4Ge | NIST Chemistry WebBook |
| Me4Ge | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:865-52-1 | NIST Chemistry WebBook |
| Citations |
|---|