EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2NO3.Zn |
| Net Charge | 0 |
| Average Mass | 189.398 |
| Monoisotopic Mass | 187.90478 |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Zn+2] |
| InChI | InChI=1S/2NO3.Zn/c2*2-1(3)4;/q2*-1;+2 |
| InChIKey | ONDPHDOFVYQSGI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Biological Role: | nutrient A nutrient is a food component that an organism uses to survive and grow. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zinc nitrate (CHEBI:231504) has part zinc(2+) (CHEBI:29105) |
| zinc nitrate (CHEBI:231504) has role NMR chemical shift reference compound (CHEBI:228364) |
| zinc nitrate (CHEBI:231504) is a inorganic nitrate salt (CHEBI:51084) |
| zinc nitrate (CHEBI:231504) is a inorganic zinc salt (CHEBI:190430) |
| IUPAC Name |
|---|
| zinc dinitrate |
| Synonyms | Source |
|---|---|
| nitric acid zinc salt | ChEBI |
| nitric acid, zinc salt | ChEBI |
| zinc(II) nitrate | ChEBI |
| Zn(NO3)2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Zinc_nitrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:7779-88-6 | ChEBI |
| Citations |
|---|