EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO4 |
| Net Charge | 0 |
| Average Mass | 167.120 |
| Monoisotopic Mass | 167.02186 |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | AFPHTEQTJZKQAQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitrobenzoic acid (CHEBI:231494) is a nitrobenzoic acid (CHEBI:25553) |
| 3-nitrobenzoic acid (CHEBI:231494) is conjugate acid of 3-nitrobenzoate (CHEBI:231488) |
| Incoming Relation(s) |
| 3-nitrobenzoate (CHEBI:231488) is conjugate base of 3-nitrobenzoic acid (CHEBI:231494) |
| IUPAC Name |
|---|
| 3-nitrobenzoic acid |
| Synonyms | Source |
|---|---|
| m-nitrobenzoic acid | ChEBI |
| m-carboxynitrobenzene | ChEBI |
| m-nitrobenzenecarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3-Nitrobenzoic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:908644 | Reaxys |
| CAS:121-92-6 | NIST Chemistry WebBook |
| Citations |
|---|