EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O5 |
| Net Charge | -2 |
| Average Mass | 160.125 |
| Monoisotopic Mass | 160.03827 |
| SMILES | CC(C(=O)[O-])C(C)(O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O5/c1-3(4(7)8)6(2,11)5(9)10/h3,11H,1-2H3,(H,7,8)(H,9,10)/p-2 |
| InChIKey | WTIIULQJLZEHGZ-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dimethylmalate(2−) (CHEBI:231468) is a 2-hydroxydicarboxylate(2−) (CHEBI:167114) |
| 2,3-dimethylmalate(2−) (CHEBI:231468) is conjugate base of 2,3-dimethylmalic acid (CHEBI:15590) |
| Incoming Relation(s) |
| 2,3-dimethylmalic acid (CHEBI:15590) is conjugate acid of 2,3-dimethylmalate(2−) (CHEBI:231468) |
| IUPAC Name |
|---|
| 2-hydroxy-2,3-dimethylbutanedioate |
| Synonyms | Source |
|---|---|
| 2,3-dimethylmalate | ChEBI |
| 2,3-dimethylmalic acid dianion | ChEBI |
| 2-hydroxy-2,3-dimethylsuccinate | ChEBI |