EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:231441 - Mo(VI)O3-molybdopterin adenosine dinucleotide(4−)
| Formula | C20H22MoN10O15P2S2 |
| Net Charge | -4 |
| Average Mass | 864.473 |
| Monoisotopic Mass | 865.92588 |
| SMILES | [H][C@@]12Nc3c(nc(N)nc3=O)N[C@]1([H])O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]1O)C1=C2[S][Mo-2](=[O])(=[O])(=[O])[S]1 |
| InChI | InChI=1S/C20H26N10O12P2S2.Mo.3O/c21-14-8-16(24-3-23-14)30(4-25-8)19-11(32)10(31)5(41-19)1-38-43(34,35)42-44(36,37)39-2-6-12(45)13(46)7-18(40-6)27-15-9(26-7)17(33)29-20(22)28-15;;;;/h3-7,10-11,18-19,26,31-32,45-46H,1-2H2,(H,34,35)(H,36,37)(H2,21,23,24)(H4,22,27,28,29,33);;;;/p-4/t5-,6-,7+,10-,11-,18-,19-;;;;/m1..../s1 |
| InChIKey | ZDGVBQQZOIGKBT-NKWKRPJXSA-J |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mo(VI)O3-molybdopterin adenosine dinucleotide(4−) (CHEBI:231441) is a Mo-molybdopterin cofactor (CHEBI:21437) |
| Mo(VI)O3-molybdopterin adenosine dinucleotide(4−) (CHEBI:231441) is a organophosphate oxoanion (CHEBI:58945) |
| UniProt Name | Source |
|---|---|
| adenylyl MoO3-molybdopterin cofactor | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26686 | MetaCyc |
| Citations |
|---|