EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12ClF3N4O |
| Net Charge | 0 |
| Average Mass | 356.735 |
| Monoisotopic Mass | 356.06517 |
| SMILES | C[C@H](Cc1nc(=O)c2cnn(-c3ccccc3Cl)c2n1)C(F)(F)F |
| InChI | InChI=1S/C15H12ClF3N4O/c1-8(15(17,18)19)6-12-21-13-9(14(24)22-12)7-20-23(13)11-5-3-2-4-10(11)16/h2-5,7-8H,6H2,1H3,(H,21,22,24)/t8-/m1/s1 |
| InChIKey | FFPXPXOAFQCNBS-MRVPVSSYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAY 73-6691 (CHEBI:231440) has role apoptosis inducer (CHEBI:68495) |
| BAY 73-6691 (CHEBI:231440) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| BAY 73-6691 (CHEBI:231440) has role neuroprotective agent (CHEBI:63726) |
| BAY 73-6691 (CHEBI:231440) has role nootropic agent (CHEBI:66980) |
| BAY 73-6691 (CHEBI:231440) is a monochlorobenzenes (CHEBI:83403) |
| BAY 73-6691 (CHEBI:231440) is a organofluorine compound (CHEBI:37143) |
| BAY 73-6691 (CHEBI:231440) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 1-(2-chlorophenyl)-6-[(2R)-3,3,3-trifluoro-2-methylpropyl]-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |
| Synonyms | Source |
|---|---|
| BAY-73-6691 | ChEBI |
| BAY736691 | SUBMITTER |
| BAY 736691 | SUBMITTER |
| 1-(2-chlorophenyl)-1,5-dihydro-6-[(2R)-3,3,3-trifluoro-2-methylpropyl]-4H-pyrazolo[3,4-d]pyrimidin-4-one | ChEBI |
| (R)-BAY 73-6691 | ChEBI |
| (R)-BAY-73-6691 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| BAY_73-6691 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:794568-92-6 | ChEBI |
| Citations |
|---|