EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23BrFN7O3 |
| Net Charge | 0 |
| Average Mass | 580.418 |
| Monoisotopic Mass | 579.10298 |
| SMILES | CC(=O)c1nn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)Nc2cccc(Br)n2)c2ccc(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C26H23BrFN7O3/c1-14(36)25-19-8-16(17-10-29-15(2)30-11-17)6-7-20(19)35(33-25)13-24(37)34-12-18(28)9-21(34)26(38)32-23-5-3-4-22(27)31-23/h3-8,10-11,18,21H,9,12-13H2,1-2H3,(H,31,32,38)/t18-,21+/m1/s1 |
| InChIKey | PIBARDGJJAGJAJ-NQIIRXRSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danicopan (CHEBI:231416) has role antiviral agent (CHEBI:22587) |
| danicopan (CHEBI:231416) has role renoprotective agent (CHEBI:231911) |
| danicopan (CHEBI:231416) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| ACH-0144471 | ChEMBL |
| ACH-4471 | ChEMBL |
| Danicopan | ChEMBL |
| Voydeya | ChEMBL |
| Citations |
|---|