EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20ClNO3S |
| Net Charge | 0 |
| Average Mass | 281.805 |
| Monoisotopic Mass | 281.08524 |
| SMILES | CC(C)(C)CN(C(=O)CCl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20ClNO3S/c1-11(2,3)8-13(10(14)6-12)9-4-5-17(15,16)7-9/h9H,4-8H2,1-3H3 |
| InChIKey | NMHVAHHYKGXBMY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 5.2.* (cis-trans-isomerase) inhibitor An isomerase inhibitor interfering with the action of a cis-trans-isomerase (EC 5.2.*.*). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfopin (CHEBI:231413) has role antineoplastic agent (CHEBI:35610) |
| sulfopin (CHEBI:231413) has role EC 5.2.* (cis-trans-isomerase) inhibitor (CHEBI:76693) |
| sulfopin (CHEBI:231413) is a organochlorine compound (CHEBI:36683) |
| sulfopin (CHEBI:231413) is a sulfone (CHEBI:35850) |
| sulfopin (CHEBI:231413) is a tertiary carboxamide (CHEBI:140326) |
| sulfopin (CHEBI:231413) is a tetrahydrothiophenes (CHEBI:48224) |
| IUPAC Name |
|---|
| 2-chloro-N-(2,2-dimethylpropyl)-N-(1,1-dioxidotetrahydrothiophen-3-yl)acetamide |
| Synonyms | Source |
|---|---|
| PIN1-3 | ChEBI |
| 2-chloro-N-(2,2-dimethylpropyl)-N-(1,1-dioxo-1λ6-thiolan-3-yl)acetamide | IUPAC |
| 2-chloro-N-(1,1-dioxidotetrahydrothiophen-3-yl)-N-neopentylacetamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2451481-08-4 | ChEBI |
| Citations |
|---|