EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20ClNO5 |
| Net Charge | 0 |
| Average Mass | 401.846 |
| Monoisotopic Mass | 401.10300 |
| SMILES | [H][C@@]1(c2c(O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)CCN(C)[C@H]1CO |
| InChI | InChI=1S/C21H20ClNO5/c1-23-7-6-12(14(23)10-24)19-15(25)8-16(26)20-17(27)9-18(28-21(19)20)11-4-2-3-5-13(11)22/h2-5,8-9,12,14,24-26H,6-7,10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | QLUYMIVVAYRECT-OCCSQVGLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| riviciclib (CHEBI:231364) has role antineoplastic agent (CHEBI:35610) |
| riviciclib (CHEBI:231364) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| riviciclib (CHEBI:231364) is a N-alkylpyrrolidine (CHEBI:46775) |
| riviciclib (CHEBI:231364) is a dihydroxyflavone (CHEBI:38686) |
| riviciclib (CHEBI:231364) is a monochlorobenzenes (CHEBI:83403) |
| riviciclib (CHEBI:231364) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-4H-chromen-4-one |
| INNs | Source |
|---|---|
| riviciclib | WHO MedNet |
| riviciclib | WHO MedNet |
| riviciclib | WHO MedNet |
| riviciclibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-4H-1-benzopyran-4-one | IUPAC |
| P-27600 free base | ChEBI |
| P276-00 free base | SUBMITTER |
| P276-00 (free base) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2010152129 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:920113-02-6 | ChEBI |
| Citations |
|---|