EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H50N8O3 |
| Net Charge | 0 |
| Average Mass | 618.827 |
| Monoisotopic Mass | 618.40059 |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)N[C@H]4CC[C@H](N5CCN(CC6CC6)CC5)CC4)cc3OC)nc2N1C(C)C |
| InChI | InChI=1S/C34H50N8O3/c1-6-28-33(44)39(4)29-20-35-34(38-31(29)42(28)22(2)3)37-27-14-9-24(19-30(27)45-5)32(43)36-25-10-12-26(13-11-25)41-17-15-40(16-18-41)21-23-7-8-23/h9,14,19-20,22-23,25-26,28H,6-8,10-13,15-18,21H2,1-5H3,(H,36,43)(H,35,37,38)/t25-,26-,28-/m1/s1 |
| InChIKey | SXNJFOWDRLKDSF-STROYTFGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| volasertib (CHEBI:231358) has role antineoplastic agent (CHEBI:35610) |
| volasertib (CHEBI:231358) has role apoptosis inducer (CHEBI:68495) |
| volasertib (CHEBI:231358) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| volasertib (CHEBI:231358) is a benzamides (CHEBI:22702) |
| volasertib (CHEBI:231358) is a cyclopropanes (CHEBI:51454) |
| volasertib (CHEBI:231358) is a monomethoxybenzene (CHEBI:25235) |
| volasertib (CHEBI:231358) is a piperazines (CHEBI:26144) |
| volasertib (CHEBI:231358) is a pteridines (CHEBI:26373) |
| volasertib (CHEBI:231358) is a secondary amino compound (CHEBI:50995) |
| volasertib (CHEBI:231358) is a secondary carboxamide (CHEBI:140325) |
| volasertib (CHEBI:231358) is a substituted aniline (CHEBI:48975) |
| volasertib (CHEBI:231358) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-{(1r,4R)-4-[4-(cyclopropylmethyl)piperazin-1-yl]cyclohexyl}-4-{[(7R)-7-ethyl-5-methyl-6-oxo-8-(propan-2-yl)-5,6,7,8-tetrahydropteridin-2-yl]amino}-3-methoxybenzamide |
| INNs | Source |
|---|---|
| volasertibum | WHO MedNet |
| volasertib | WHO MedNet |
| volasertib | WHO MedNet |
| volasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BI-6727 | SUBMITTER |
| BI 6727 | SUBMITTER |
| BI6727 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB12062 | DrugBank |
| HMDB0259868 | HMDB |
| Volasertib | Wikipedia |
| D10182 | KEGG DRUG |
| IBI | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:755038-65-4 | KEGG DRUG |
| Citations |
|---|