EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17F3N2O4 |
| Net Charge | 0 |
| Average Mass | 406.360 |
| Monoisotopic Mass | 406.11404 |
| SMILES | COc1cccc2c1c(O)c(C(=O)N(C)c1ccc(C(F)(F)F)cc1)c(=O)n2C |
| InChI | InChI=1S/C20H17F3N2O4/c1-24(12-9-7-11(8-10-12)20(21,22)23)18(27)16-17(26)15-13(25(2)19(16)28)5-4-6-14(15)29-3/h4-10,26H,1-3H3 |
| InChIKey | ONDYALNGTUAJDX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasquinimod (CHEBI:231355) has role antineoplastic agent (CHEBI:35610) |
| tasquinimod (CHEBI:231355) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| tasquinimod | WHO MedNet |
| Synonym | Source |
|---|---|
| ABR-215050 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:254964-60-8 | SUBMITTER |
| Citations |
|---|