EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O4S |
| Net Charge | 0 |
| Average Mass | 349.412 |
| Monoisotopic Mass | 349.10963 |
| SMILES | CN(C)Cc1ccc(S(=O)(=O)n2ccc(/C=C/C(=O)NO)c2)cc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-18(2)11-13-3-6-15(7-4-13)24(22,23)19-10-9-14(12-19)5-8-16(20)17-21/h3-10,12,21H,11H2,1-2H3,(H,17,20)/b8-5+ |
| InChIKey | FECGNJPYVFEKOD-VMPITWQZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resminostat (CHEBI:231352) has role antineoplastic agent (CHEBI:35610) |
| resminostat (CHEBI:231352) has role apoptosis inducer (CHEBI:68495) |
| resminostat (CHEBI:231352) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| resminostat (CHEBI:231352) is a benzenes (CHEBI:22712) |
| resminostat (CHEBI:231352) is a enamide (CHEBI:51751) |
| resminostat (CHEBI:231352) is a hydroxamic acid (CHEBI:24650) |
| resminostat (CHEBI:231352) is a pyrroles (CHEBI:26455) |
| resminostat (CHEBI:231352) is a sulfonamide (CHEBI:35358) |
| resminostat (CHEBI:231352) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2E)-3-[1-({4-[(dimethylamino)methyl]phenyl}sulfonyl)-1H-pyrrol-3-yl]-N-hydroxyprop-2-enamide |
| Synonyms | Source |
|---|---|
| 4SC-201 | DrugBank |
| BYK 408740 | ChEBI |
| BYK-408740 | DrugBank |
| BYK408740 | DrugBank |
| RAS 2410 | ChEBI |
| RAS-2410 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB12392 | DrugBank |
| P7D | PDBeChem |
| Resminostat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:864814-88-0 | SUBMITTER |
| Citations |
|---|