EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16ClN5O3 |
| Net Charge | 0 |
| Average Mass | 409.833 |
| Monoisotopic Mass | 409.09417 |
| SMILES | CNC(=O)c1cc(COc2nnc(Nc3ccc(Cl)cc3)c3ccoc23)ccn1 |
| InChI | InChI=1S/C20H16ClN5O3/c1-22-19(27)16-10-12(6-8-23-16)11-29-20-17-15(7-9-28-17)18(25-26-20)24-14-4-2-13(21)3-5-14/h2-10H,11H2,1H3,(H,22,27)(H,24,25) |
| InChIKey | QFCXANHHBCGMAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telatinib (CHEBI:231351) has role angiogenesis inhibitor (CHEBI:48422) |
| telatinib (CHEBI:231351) has role antineoplastic agent (CHEBI:35610) |
| telatinib (CHEBI:231351) has role apoptosis inducer (CHEBI:68495) |
| telatinib (CHEBI:231351) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| telatinib (CHEBI:231351) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| telatinib (CHEBI:231351) is a anilines (CHEBI:22562) |
| telatinib (CHEBI:231351) is a aromatic ether (CHEBI:35618) |
| telatinib (CHEBI:231351) is a furopyridazine (CHEBI:231410) |
| telatinib (CHEBI:231351) is a monochlorobenzenes (CHEBI:83403) |
| telatinib (CHEBI:231351) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| 4-({[4-(4-chloroanilino)furo[2,3-d]pyridazin-7-yl]oxy}methyl)-N-methylpyridine-2-carboxamide |
| INNs | Source |
|---|---|
| telatinib | WHO MedNet |
| telatinibum | WHO MedNet |
| télatinib | WHO MedNet |
| telatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 57-9352 | SUBMITTER |
| 4-(((4-((4-chlorophenyl)amino)furo[2,3-d]pyridazin-7-yl)oxy)methyl)-N-methylpicolinamide | ChEBI |
| 4-[[[4-[(4-chlorophenyl)amino]furo[2,3-d]pyridazin-7-yl]oxy]methyl]-N-methyl-2-pyridinecarboxamide | ChEBI |
| BAY-579352 | ChEBI |
| BAY-57-9352 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB15393 | DrugBank |
| HMDB0258783 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:332012-40-5 | SUBMITTER |
| Citations |
|---|