EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16ClN5O3 |
| Net Charge | 0 |
| Average Mass | 409.833 |
| Monoisotopic Mass | 409.09417 |
| SMILES | CNC(=O)c1cc(COc2nnc(Nc3ccc(Cl)cc3)c3ccoc23)ccn1 |
| InChI | InChI=1S/C20H16ClN5O3/c1-22-19(27)16-10-12(6-8-23-16)11-29-20-17-15(7-9-28-17)18(25-26-20)24-14-4-2-13(21)3-5-14/h2-10H,11H2,1H3,(H,22,27)(H,24,25) |
| InChIKey | QFCXANHHBCGMAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telatinib (CHEBI:231351) has role angiogenesis inhibitor (CHEBI:48422) |
| telatinib (CHEBI:231351) has role antineoplastic agent (CHEBI:35610) |
| telatinib (CHEBI:231351) has role apoptosis inducer (CHEBI:68495) |
| telatinib (CHEBI:231351) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| telatinib (CHEBI:231351) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| telatinib (CHEBI:231351) is a anilines (CHEBI:22562) |
| telatinib (CHEBI:231351) is a aromatic ether (CHEBI:35618) |
| telatinib (CHEBI:231351) is a furopyridazine (CHEBI:231410) |
| telatinib (CHEBI:231351) is a monochlorobenzenes (CHEBI:83403) |
| telatinib (CHEBI:231351) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| 4-({[4-(4-chloroanilino)furo[2,3-d]pyridazin-7-yl]oxy}methyl)-N-methylpyridine-2-carboxamide |
| INNs | Source |
|---|---|
| telatinib | WHO MedNet |
| telatinib | WHO MedNet |
| télatinib | WHO MedNet |
| telatinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-[[[4-[(4-chlorophenyl)amino]furo[2,3-d]pyridazin-7-yl]oxy]methyl]-N-methyl-2-pyridinecarboxamide | ChEBI |
| 4-(((4-((4-chlorophenyl)amino)furo[2,3-d]pyridazin-7-yl)oxy)methyl)-N-methylpicolinamide | ChEBI |
| BAY 57-9352 | SUBMITTER |
| BAY-57-9352 | ChEBI |
| BAY-579352 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB15393 | DrugBank |
| HMDB0258783 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:332012-40-5 | SUBMITTER |
| Citations |
|---|