EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N5S |
| Net Charge | 0 |
| Average Mass | 195.251 |
| Monoisotopic Mass | 195.05787 |
| SMILES | [H]C(=NNC(N)=S)c1ncccc1N |
| InChI | InChI=1S/C7H9N5S/c8-5-2-1-3-10-6(5)4-11-12-7(9)13/h1-4H,8H2,(H3,9,12,13) |
| InChIKey | XMYKNCNAZKMVQN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor An EC 1.17.* (oxidoreductase acting on CH or CH2) inhibitor that inhibits the action of ribonucleoside-diphosphate reductase (EC 1.17.4.1). |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triapine (CHEBI:231347) has functional parent 3-aminopicolinaldehyde (CHEBI:231207) |
| triapine (CHEBI:231347) has role antineoplastic agent (CHEBI:35610) |
| triapine (CHEBI:231347) has role apoptosis inducer (CHEBI:68495) |
| triapine (CHEBI:231347) has role EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor (CHEBI:74213) |
| triapine (CHEBI:231347) has role iron chelator (CHEBI:38157) |
| triapine (CHEBI:231347) has role neuroprotective agent (CHEBI:63726) |
| triapine (CHEBI:231347) has role radiosensitizing agent (CHEBI:132992) |
| triapine (CHEBI:231347) is a aminopyridine (CHEBI:38207) |
| triapine (CHEBI:231347) is a thiosemicarbazone (CHEBI:156467) |
| IUPAC Name |
|---|
| 2-[(3-aminopyridin-2-yl)methylidene]hydrazinecarbothioamide |
| Synonyms | Source |
|---|---|
| 3-AP | SUBMITTER |
| OCX 191 | SUBMITTER |
| 2-[(3-aminopyridin-2-yl)methylidene]hydrazine-1-carbothioamide | IUPAC |
| 2-[(3-amino-2-pyridinyl)methylene]hydrazinecarbothioamide | ChEBI |
| 3-aminopyridine-2-carboxaldehyde thiosemicarbazone | ChEBI |
| PAN 811 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB11940 | DrugBank |
| 3-Aminopyridine-2-carboxaldehyde_thiosemicarbazone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5811939 | Reaxys |
| CAS:143621-35-6 | ChEBI |
| Citations |
|---|