EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O3 |
| Net Charge | 0 |
| Average Mass | 240.258 |
| Monoisotopic Mass | 240.07864 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1ccccc1O |
| InChI | InChI=1S/C15H12O3/c16-12-8-5-11(6-9-12)7-10-15(18)13-3-1-2-4-14(13)17/h1-10,16-17H/b10-7+ |
| InChIKey | FGPJTMCJNPRZGF-JXMROGBWSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,2'-dihydroxychalcone (CHEBI:231338) is a trans-chalcone (CHEBI:48965) |
| UniProt Name | Source |
|---|---|
| 4,2'-dihydroxychalcone | UniProt |
| Citations |
|---|