EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N3O4.H2O.HCl |
| Net Charge | 0 |
| Average Mass | 475.973 |
| Monoisotopic Mass | 475.18740 |
| SMILES | CCN(CC)Cc1ccc2cc(COC(=O)Nc3ccc(C(=O)NO)cc3)ccc2c1.Cl.O |
| InChI | InChI=1S/C24H27N3O4.ClH.H2O/c1-3-27(4-2)15-17-5-7-21-14-18(6-8-20(21)13-17)16-31-24(29)25-22-11-9-19(10-12-22)23(28)26-30;;/h5-14,30H,3-4,15-16H2,1-2H3,(H,25,29)(H,26,28);1H;1H2 |
| InChIKey | FKGKZBBDJSKCIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| givinostat hydrochloride monohydrate (CHEBI:231335) has part givinostat hydrochloride (CHEBI:231333) |
| givinostat hydrochloride monohydrate (CHEBI:231335) has role angiogenesis inhibitor (CHEBI:48422) |
| givinostat hydrochloride monohydrate (CHEBI:231335) has role anti-inflammatory agent (CHEBI:67079) |
| givinostat hydrochloride monohydrate (CHEBI:231335) has role antineoplastic agent (CHEBI:35610) |
| givinostat hydrochloride monohydrate (CHEBI:231335) has role apoptosis inducer (CHEBI:68495) |
| givinostat hydrochloride monohydrate (CHEBI:231335) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| givinostat hydrochloride monohydrate (CHEBI:231335) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| {6-[(diethylamino)methyl]naphthalen-2-yl}methyl [4-(hydroxycarbamoyl)phenyl]carbamate hydrochloride hydrate |
| Synonyms | Source |
|---|---|
| [6-(diethylaminomethyl)naphthalen-2-yl]methyl[4(hydroxycarbamoyl)phenyl]carbamate hydrochloride monohydrate | ChEBI |
| {6-[(diethylamino)methyl]naphthalen-2-yl}methyl [4-(hydroxycarbamoyl)phenyl]carbamate—hydrogen chloride—water (1/1/1) | IUPAC |
| givinostat hydrochloride hydrate | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Duvyzat | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D12743 | KEGG DRUG |
| DBSALT003496 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:732302-99-7 | KEGG DRUG |