EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27ClN2O |
| Net Charge | 0 |
| Average Mass | 370.924 |
| Monoisotopic Mass | 370.18119 |
| SMILES | CCC(=O)N(c1ccc(Cl)cc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27ClN2O/c1-2-22(26)25(20-10-8-19(23)9-11-20)21-13-16-24(17-14-21)15-12-18-6-4-3-5-7-18/h3-11,21H,2,12-17H2,1H3 |
| InChIKey | CUGMWAHBYRKBKL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chlorofentanyl (CHEBI:231308) has role opioid analgesic (CHEBI:35482) |
| 4-chlorofentanyl (CHEBI:231308) has role μ-opioid receptor agonist (CHEBI:55322) |
| 4-chlorofentanyl (CHEBI:231308) is a monocarboxylic acid amide (CHEBI:29347) |
| 4-chlorofentanyl (CHEBI:231308) is a monochlorobenzenes (CHEBI:83403) |
| 4-chlorofentanyl (CHEBI:231308) is a piperidines (CHEBI:26151) |
| 4-chlorofentanyl (CHEBI:231308) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(4-chlorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| Synonyms | Source |
|---|---|
| N-(4-chlorophenyl)-N-[1-(2-phenylethyl)-4-piperidinyl]-propanamide | ChEBI |
| N-(4-chlorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide | ChEBI |
| N-(4-chlorophenyl)-N-(1-phenethylpiperidin-4-yl)propionamide | ChEBI |
| para-chlorofentanyl | ChEBI |
| p-chlorofentanyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 459384 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:117994-22-6 | ChEBI |