EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8FNO2 |
| Net Charge | 0 |
| Average Mass | 169.155 |
| Monoisotopic Mass | 169.05391 |
| SMILES | NC(C(=O)O)c1ccccc1F |
| InChI | InChI=1S/C8H8FNO2/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12) |
| InChIKey | CGNMJIBUVDGMIY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DL-2-Fluorophenylglycine (CHEBI:231282) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-2-(2-fluorophenyl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 504221 | ChemSpider |