EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N |
| Net Charge | 0 |
| Average Mass | 135.210 |
| Monoisotopic Mass | 135.10480 |
| SMILES | CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C9H13N/c1-10(2)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | XXBDWLFCJWSEKW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-Dimethylbenzylamine (CHEBI:231275) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-phenylmethanamine |
| Manual Xrefs | Databases |
|---|---|
| 7398 | ChemSpider |
| HMDB0255260 | HMDB |