EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N4O3 |
| Net Charge | +1 |
| Average Mass | 205.238 |
| Monoisotopic Mass | 205.12952 |
| SMILES | NC(=[NH2+])NC(O)CCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H16N4O3/c8-4(6(13)14)2-1-3-5(12)11-7(9)10/h4-5,12H,1-3,8H2,(H,13,14)(H4,9,10,11)/p+1/t4-,5?/m0/s1 |
| InChIKey | LAXHMXWVQGTYCV-ROLXFIACSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-L-homoarginine(1+) (CHEBI:231270) has functional parent L-homoarginine(1+) (CHEBI:143006) |
| 6-hydroxy-L-homoarginine(1+) (CHEBI:231270) is a guanidinium ion (CHEBI:60251) |
| 6-hydroxy-L-homoarginine(1+) (CHEBI:231270) is a homoarginine (CHEBI:24606) |
| UniProt Name | Source |
|---|---|
| 6-hydroxy-L-homoarginine | UniProt |
| Citations |
|---|