EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O3S |
| Net Charge | 0 |
| Average Mass | 164.186 |
| Monoisotopic Mass | 164.02556 |
| SMILES | N[C@@H](CCSN=O)C(=O)O |
| InChI | InChI=1S/C4H8N2O3S/c5-3(4(7)8)1-2-10-6-9/h3H,1-2,5H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | QWPCKAAAWDCDCW-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-Nitrosohomocysteine (CHEBI:231262) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-nitrososulanylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23327703 | ChemSpider |