EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O5 |
| Net Charge | 0 |
| Average Mass | 344.367 |
| Monoisotopic Mass | 344.13722 |
| SMILES | CC(N)C(=O)N(c1ccc2ccccc2c1)C(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H20N2O5/c1-11(19)17(23)20(15(18(24)25)8-9-16(21)22)14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10-11,15H,8-9,19H2,1H3,(H,21,22)(H,24,25) |
| InChIKey | HPKYNEZNHPFKGT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-[[(2S)-2-Aminopropanoyl]-naphthalen-2-ylamino]pentanedioic acid (CHEBI:231248) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[2-aminopropanoyl(naphthalen-2-yl)amino]pentanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0260140 | HMDB |