EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O5 |
| Net Charge | 0 |
| Average Mass | 267.241 |
| Monoisotopic Mass | 267.08552 |
| SMILES | C#C[C@@]1(O)[C@@H](CO)O[C@@H](n2ccc(N)nc2=O)[C@@H]1O |
| InChI | InChI=1S/C11H13N3O5/c1-2-11(18)6(5-15)19-9(8(11)16)14-4-3-7(12)13-10(14)17/h1,3-4,6,8-9,15-16,18H,5H2,(H2,12,13,17)/t6-,8+,9-,11-/m1/s1 |
| InChIKey | JFIWEPHGRUDAJN-DYUFWOLASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-C-Ethynylcytidine (CHEBI:231178) has role antineoplastic agent (CHEBI:35610) |
| 3'-C-Ethynylcytidine (CHEBI:231178) is a pyrimidine nucleoside (CHEBI:26440) |
| IUPAC Name |
|---|
| 4-amino-1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| Synonyms | Source |
|---|---|
| 2'-c-ethynylcytidine | ChEMBL |
| 3'-c-ethynylcytidine | ChEMBL |
| tas-106 | ChEMBL |
| Tas 106 | ChEMBL |
| Tas-106 | ChEMBL |
| Citations |
|---|