EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42N2O3 |
| Net Charge | 0 |
| Average Mass | 466.666 |
| Monoisotopic Mass | 466.31954 |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)NC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H42N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-28(32)31-27(29(33)34)22-24-23-30-26-20-18-17-19-25(24)26/h6-7,9-10,17-20,23,27,30H,2-5,8,11-16,21-22H2,1H3,(H,31,32)(H,33,34)/b7-6+,10-9+ |
| InChIKey | VMJGIIURAHPLEX-AVQMFFATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Linoleoyl Tryptophan (CHEBI:231162) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 3-(1H-indol-3-yl)-2-[[(9E,12E)-octadeca-9,12-dienoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 128530245 | ChemSpider |