EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N5O |
| Net Charge | 0 |
| Average Mass | 211.269 |
| Monoisotopic Mass | 211.14331 |
| SMILES | CCN(CC(C)O)c1ccc(NN)nn1 |
| InChI | InChI=1S/C9H17N5O/c1-3-14(6-7(2)15)9-5-4-8(11-10)12-13-9/h4-5,7,15H,3,6,10H2,1-2H3,(H,11,12) |
| InChIKey | OWMCFGLDBWRVDZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[Ethyl-(6-hydrazinylpyridazin-3-yl)amino]propan-2-ol (CHEBI:231131) is a dialkylarylamine (CHEBI:23665) |
| 1-[Ethyl-(6-hydrazinylpyridazin-3-yl)amino]propan-2-ol (CHEBI:231131) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-[ethyl-(6-hydrazinylpyridazin-3-yl)amino]propan-2-ol |
| Manual Xrefs | Databases |
|---|---|
| 114948 | ChemSpider |
| HMDB0243808 | HMDB |