EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O3 |
| Net Charge | 0 |
| Average Mass | 426.641 |
| Monoisotopic Mass | 426.31340 |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/CC[C@@]1(C)CCc2cc(O)c(C)c(C)c2O1)CO |
| InChI | InChI=1S/C28H42O3/c1-20(12-8-13-22(3)19-29)10-7-11-21(2)14-9-16-28(6)17-15-25-18-26(30)23(4)24(5)27(25)31-28/h10,13-14,18,29-30H,7-9,11-12,15-17,19H2,1-6H3/b20-10+,21-14+,22-13+/t28-/m0/s1 |
| InChIKey | BUWYMGRHXZROTQ-XYSSNJNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) | |
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13'-Hydroxy-gamma-tocotrienol (CHEBI:231108) is a tocotrienol (CHEBI:33235) |
| IUPAC Name |
|---|
| (2S)-2-[(3E,7E,11E)-13-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,7,8-trimethyl-3,4-dihydrochromen-6-ol |
| Manual Xrefs | Databases |
|---|---|
| 30776636 | ChemSpider |
| HMDB0012562 | HMDB |