EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H74N2O7S |
| Net Charge | 0 |
| Average Mass | 739.117 |
| Monoisotopic Mass | 738.52167 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)N[C@@H](CO)C(O)C(O)CCCCCCCCCCCCCC)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C41H74N2O7S/c1-3-5-7-9-11-13-15-17-19-21-23-25-28-37(46)40(49)35(32-44)43-41(50)34(42)33-51-38(36(45)29-27-31-39(47)48)30-26-24-22-20-18-16-14-12-10-8-6-4-2/h12,14,18,20,22,24,26,30,34-38,40,44-46,49H,3-11,13,15-17,19,21,23,25,27-29,31-33,42H2,1-2H3,(H,43,50)(H,47,48)/b14-12-,20-18-,24-22+,30-26+/t34-,35-,36-,37?,38+,40?/m0/s1 |
| InChIKey | GSCKCDNNKNVICD-RVUVIFDUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cer(t18:0/LTE4) (CHEBI:230927) is a hydroxy fatty acid (CHEBI:24654) |
| Cer(t18:0/LTE4) (CHEBI:230927) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-oxo-3-[[(2S)-1,3,4-trihydroxyoctadecan-2-yl]amino]propyl]sulanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0290166 | HMDB |