EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N8O |
| Net Charge | 0 |
| Average Mass | 434.548 |
| Monoisotopic Mass | 434.25426 |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(N4CCNCC4)cn3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C23H30N8O/c1-29(2)22(32)19-13-16-14-26-23(28-21(16)31(19)17-5-3-4-6-17)27-20-8-7-18(15-25-20)30-11-9-24-10-12-30/h7-8,13-15,17,24H,3-6,9-12H2,1-2H3,(H,25,26,27,28) |
| InChIKey | RHXHGRAEPCAFML-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ribociclib (CHEBI:230905) has role antifibrotic agent (CHEBI:233423) |
| Ribociclib (CHEBI:230905) has role antineoplastic agent (CHEBI:35610) |
| Ribociclib (CHEBI:230905) has role renoprotective agent (CHEBI:231911) |
| Ribociclib (CHEBI:230905) is a piperazines (CHEBI:26144) |
| Ribociclib (CHEBI:230905) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 7-cyclopentyl-N,N-dimethyl-2-[(5-piperazin-1-ylpyridin-2-yl)amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| Synonyms | Source |
|---|---|
| LEE-011 | ChEMBL |
| LEE011 | ChEMBL |
| LEE-011A | ChEMBL |
| LEE011A | ChEMBL |
| NVP-LEE011 | ChEMBL |
| Ribociclib | ChEMBL |
| Citations |
|---|