EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8NO2.Na |
| Net Charge | 0 |
| Average Mass | 197.169 |
| Monoisotopic Mass | 197.04527 |
| SMILES | O=C([O-])Cc1cnc2ccccc12.[Na+] |
| InChI | InChI=1S/C10H9NO2.Na/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9;/h1-4,6,11H,5H2,(H,12,13);/q;+1/p-1 |
| InChIKey | YGSPWCVTJRFZEL-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indole-3-acetic acid sodium salt (CHEBI:230840) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| sodium;2-(1H-indol-3-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 21170167 | ChemSpider |