EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36N4O7 |
| Net Charge | 0 |
| Average Mass | 588.661 |
| Monoisotopic Mass | 588.25840 |
| SMILES | C[C@H](NC(=O)[C@H](C)NC(CCc1ccccc1)C(=O)O)C(=O)NC(=O)[C@H](Cc1ccccc1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H36N4O7/c1-20(33-26(32(42)43)18-13-22-9-5-3-6-10-22)28(37)34-21(2)29(38)36-30(39)27(19-23-11-7-4-8-12-23)35-25-16-14-24(15-17-25)31(40)41/h3-12,14-17,20-21,26-27,33,35H,13,18-19H2,1-2H3,(H,34,37)(H,40,41)(H,42,43)(H,36,38,39)/t20-,21-,26?,27-/m0/s1 |
| InChIKey | UZKWDJFXHHHJFU-FFXSJNGMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cfp-aaf-pab (CHEBI:230823) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 4-[[(2S)-1-[[(2S)-2-[[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]amino]propanoyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4677831 | ChemSpider |