EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N4O5 |
| Net Charge | 0 |
| Average Mass | 286.288 |
| Monoisotopic Mass | 286.12772 |
| SMILES | CC(CN(CC(N)=O)CC(=O)O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H18N4O5/c1-7(15-4-9(17)13-10(18)5-15)2-14(3-8(12)16)6-11(19)20/h7H,2-6H2,1H3,(H2,12,16)(H,19,20)(H,13,17,18) |
| InChIKey | NMKSQOBSNDOTQH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(3,5-Dioxopiperazino)propyl]-N-(2-amino-2-oxoethyl)glycine (CHEBI:230816) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-[(2-amino-2-oxoethyl)-[2-(3,5-dioxopiperazin-1-yl)propyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0255034 | HMDB |
| 8146813 | ChemSpider |