EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O4 |
| Net Charge | 0 |
| Average Mass | 186.207 |
| Monoisotopic Mass | 186.08921 |
| SMILES | CC1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C9H14O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h5-7H,2-4H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | YWVFNWVZBAWOOY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-Cyclohexanedicarboxylic acid, 4-methyl- (CHEBI:230809) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 4-methylcyclohexane-1,2-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 84596 | ChemSpider |
| HMDB0253138 | HMDB |