EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28FN3O8 |
| Net Charge | 0 |
| Average Mass | 481.477 |
| Monoisotopic Mass | 481.18604 |
| SMILES | CC(NC(=O)C(N)C(C)C)C(=O)N(C(=O)OCc1ccccc1)C(CC(=O)O)C(=O)C(=O)CF |
| InChI | InChI=1S/C22H28FN3O8/c1-12(2)18(24)20(31)25-13(3)21(32)26(15(9-17(28)29)19(30)16(27)10-23)22(33)34-11-14-7-5-4-6-8-14/h4-8,12-13,15,18H,9-11,24H2,1-3H3,(H,25,31)(H,28,29) |
| InChIKey | KZAABXGRCQBNKB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-[[(2S)-2-[[(2S)-2-Amino-3-methylbutanoyl]amino]propanoyl]-phenylmethoxycarbonylamino]-6-fluoro-4,5-dioxohexanoic acid (CHEBI:230787) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 3-[2-[(2-amino-3-methylbutanoyl)amino]propanoyl-phenylmethoxycarbonylamino]-6-luoro-4,5-dioxohexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0257943 | HMDB |