EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10F2N2O3 |
| Net Charge | 0 |
| Average Mass | 316.263 |
| Monoisotopic Mass | 316.06595 |
| SMILES | COc1cc(F)cc2c1-c1ccc(F)cc1C21NC(=O)NC1=O |
| InChI | InChI=1S/C16H10F2N2O3/c1-23-12-6-8(18)5-11-13(12)9-3-2-7(17)4-10(9)16(11)14(21)19-15(22)20-16/h2-6H,1H3,(H2,19,20,21,22) |
| InChIKey | FYDPXVSFSSBHGW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,7-Difluoro-4-methoxyspiro[fluorene-9,5'-imidazolidine]-2',4'-dione (CHEBI:230768) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 2,7-diluoro-4-methoxyspiro[luorene-9,5'-imidazolidine]-2',4'-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0248091 | HMDB |
| 140259 | ChemSpider |