EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O2 |
| Net Charge | 0 |
| Average Mass | 187.243 |
| Monoisotopic Mass | 187.13208 |
| SMILES | N=CCNC(CCCCN)C(=O)O |
| InChI | InChI=1S/C8H17N3O2/c9-4-2-1-3-7(8(12)13)11-6-5-10/h5,7,10-11H,1-4,6,9H2,(H,12,13) |
| InChIKey | NNRMAICNBIUGOW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-6-Amino-2-(2-iminoethylamino)hexanoic Acid (CHEBI:230733) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 6-amino-2-(2-iminoethylamino)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16349091 | ChemSpider |
| HMDB0253432 | HMDB |