EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20NO10S3 |
| Net Charge | -1 |
| Average Mass | 422.479 |
| Monoisotopic Mass | 422.02548 |
| SMILES | CS(=O)CCC/C(=N/OS(=O)(=O)[O-])SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C11H21NO10S3/c1-24(17)4-2-3-7(12-22-25(18,19)20)23-11-10(16)9(15)8(14)6(5-13)21-11/h6,8-11,13-16H,2-5H2,1H3,(H,18,19,20)/p-1/b12-7- |
| InChIKey | PHYYADMVYQURSX-GHXNOFRVSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylsulfinylpropyl-glucosinolate (CHEBI:230695) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [(Z)-[4-methylsulinyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulanylbutylidene]amino] sulate |