EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO4 |
| Net Charge | 0 |
| Average Mass | 207.185 |
| Monoisotopic Mass | 207.05316 |
| SMILES | COc1cc2cc(C(=O)O)nc2cc1O |
| InChI | InChI=1S/C10H9NO4/c1-15-9-3-5-2-7(10(13)14)11-6(5)4-8(9)12/h2-4,11-12H,1H3,(H,13,14) |
| InChIKey | OOOLUJRYYOCWMC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Hydroxy-5-methoxy-1h-indole-2-carboxylic acid (CHEBI:230692) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 6-hydroxy-5-methoxy-1H-indole-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 109065 | ChemSpider |
| HMDB0245714 | HMDB |
| D85393 | KEGG DRUG |