EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O20 |
| Net Charge | 0 |
| Average Mass | 556.298 |
| Monoisotopic Mass | 556.02964 |
| SMILES | CN(C(=O)O)C(C(=O)O)(C(=O)O)C(C(=O)O)(C(=O)O)C(C(=O)O)(C(=O)O)C(C(=O)O)(C(=O)O)C(N)C(=O)O |
| InChI | InChI=1S/C16H16N2O20/c1-18(12(37)38)16(10(33)34,11(35)36)15(8(29)30,9(31)32)14(6(25)26,7(27)28)13(4(21)22,5(23)24)2(17)3(19)20/h2H,17H2,1H3,(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | KLZLEXIXVMJJSP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Amino-1-[carboxy(methyl)amino]pentane-1,1,2,2,3,3,4,4,5-nonacarboxylic acid (CHEBI:230652) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 5-amino-1-[carboxy(methyl)amino]pentane-1,1,2,2,3,3,4,4,5-nonacarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0260380 | HMDB |