EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O8S |
| Net Charge | 0 |
| Average Mass | 415.424 |
| Monoisotopic Mass | 415.10494 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)CCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C16H21N3O8S/c1-7(20)27-5-8-6-28-14-11(13(22)19(14)12(8)16(25)26)18-10(21)4-2-3-9(17)15(23)24/h9,11,14H,2-6,17H2,1H3,(H,18,21)(H,23,24)(H,25,26)/t9-,11-,14-/m1/s1 |
| InChIKey | HOKIDJSKDBPKTQ-GLXFQSAKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephalosporin C (CHEBI:15776) has functional parent cephalosporanic acid (CHEBI:23064) |
| cephalosporin C (CHEBI:15776) has role fungal metabolite (CHEBI:76946) |
| cephalosporin C (CHEBI:15776) is a cephalosporin (CHEBI:23066) |
| cephalosporin C (CHEBI:15776) is conjugate acid of cephalosporin C(1−) (CHEBI:57511) |
| Incoming Relation(s) |
| deacetoxycephalosporin C (CHEBI:18229) has functional parent cephalosporin C (CHEBI:15776) |
| cephalosporin C(1−) (CHEBI:57511) is conjugate base of cephalosporin C (CHEBI:15776) |
| IUPAC Name |
|---|
| (6R,7R)-3-[(acetyloxy)methyl]-7-{[(5R)-5-amino-5-carboxypentanoyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 7-(5-Amino-5-carboxyvaleramido)cephalosporanic acid | ChemIDplus |
| Cephalosporin C | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00916 | KEGG COMPOUND |
| Cephalosporin_C | Wikipedia |
| CSC | MetaCyc |
| CSC | PDBeChem |
| DB03313 | DrugBank |
| HMDB0060450 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:65348 | Reaxys |
| CAS:61-24-5 | KEGG COMPOUND |
| CAS:61-24-5 | ChemIDplus |
| Citations |
|---|