EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO5S |
| Net Charge | 0 |
| Average Mass | 257.267 |
| Monoisotopic Mass | 257.03579 |
| SMILES | [H][C@@]12CC(=O)N1C(C(=O)O)=C(COC(C)=O)CS2 |
| InChI | InChI=1S/C10H11NO5S/c1-5(12)16-3-6-4-17-8-2-7(13)11(8)9(6)10(14)15/h8H,2-4H2,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | YGBFLZPYDUKSPT-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephalosporanic acid (CHEBI:23064) is a cephalosporin (CHEBI:23066) |
| Incoming Relation(s) |
| (7R)-7-(4-carboxybutanamido)cephalosporanic acid (CHEBI:41425) has functional parent cephalosporanic acid (CHEBI:23064) |
| 7β-aminocephalosporanic acid (CHEBI:2255) has functional parent cephalosporanic acid (CHEBI:23064) |
| 7β-aminodeacetoxycephalosporanic acid (CHEBI:64984) has functional parent cephalosporanic acid (CHEBI:23064) |
| cephalosporin C (CHEBI:15776) has functional parent cephalosporanic acid (CHEBI:23064) |
| IUPAC Name |
|---|
| (6R)-3-[(acetyloxy)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |