EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H40N2O3 |
| Net Charge | 0 |
| Average Mass | 488.672 |
| Monoisotopic Mass | 488.30389 |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)NC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C31H40N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-30(34)33-29(31(35)36)24-26-25-32-28-22-20-19-21-27(26)28/h3-4,6-7,9-10,12-13,15-16,19-22,25,29,32H,2,5,8,11,14,17-18,23-24H2,1H3,(H,33,34)(H,35,36)/b4-3+,7-6+,10-9+,13-12+,16-15+ |
| InChIKey | YZGJMCYDDFORAO-RCHUDCCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Eicosapentaenoyl Tryptophan (CHEBI:230618) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 128530299 | ChemSpider |