EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O3 |
| Net Charge | 0 |
| Average Mass | 310.353 |
| Monoisotopic Mass | 310.13174 |
| SMILES | O=C1Cc2c(ccc3c2O[C@@H](CNCc2ccccc2)CO3)N1 |
| InChI | InChI=1S/C18H18N2O3/c21-17-8-14-15(20-17)6-7-16-18(14)23-13(11-22-16)10-19-9-12-4-2-1-3-5-12/h1-7,13,19H,8-11H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | DYJIKHYBKVODAC-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aplindore (CHEBI:230598) has role antiparkinson drug (CHEBI:48407) |
| aplindore (CHEBI:230598) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (2S)-2-[(benzylamino)methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one |
| INNs | Source |
|---|---|
| aplindor | WHO MedNet |
| aplindore | WHO MedNet |