EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N2O3 |
| Net Charge | 0 |
| Average Mass | 306.406 |
| Monoisotopic Mass | 306.19434 |
| SMILES | O=C(CO)NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C17H26N2O3/c20-14-17(21)18-8-5-11-22-16-7-4-6-15(12-16)13-19-9-2-1-3-10-19/h4,6-7,12,20H,1-3,5,8-11,13-14H2,(H,18,21) |
| InChIKey | BCCREUFCSIMJFS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roxatidine (CHEBI:230550) has role anti-ulcer drug (CHEBI:49201) |
| roxatidine (CHEBI:230550) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-hydroxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]acetamide |
| INN | Source |
|---|---|
| roxatidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Desacetyl-tzu-0460 | ChEMBL |
| Roxatidine | ChEMBL |
| Roxit | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 82423 | ChemSpider |
| D08494 | KEGG DRUG |
| HMDB0257317 | HMDB |