EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25N5O5S |
| Net Charge | 0 |
| Average Mass | 495.561 |
| Monoisotopic Mass | 495.15764 |
| SMILES | CN(C[C@@H]1COCCO1)S(=O)(=O)Nc1ccc2ccc3ncc(-c4cnn(C)c4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C24H25N5O5S/c1-28-13-18(12-26-28)17-9-22-23(25-11-17)6-4-16-3-5-19(10-21(16)24(22)30)27-35(31,32)29(2)14-20-15-33-7-8-34-20/h3-6,9-13,20,27H,7-8,14-15H2,1-2H3/t20-/m1/s1 |
| InChIKey | JGEBLDKNWBUGRZ-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. c-Met tyrosine kinase inhibitor An EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor that interferes with the action of c-Met tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MK-2461 (CHEBI:230540) has role antineoplastic agent (CHEBI:35610) |
| MK-2461 (CHEBI:230540) has role apoptosis inducer (CHEBI:68495) |
| MK-2461 (CHEBI:230540) has role c-Met tyrosine kinase inhibitor (CHEBI:90199) |
| MK-2461 (CHEBI:230540) is a benzocycloheptapyridine (CHEBI:48593) |
| MK-2461 (CHEBI:230540) is a dioxanes (CHEBI:46926) |
| MK-2461 (CHEBI:230540) is a pyrazoles (CHEBI:26410) |
| MK-2461 (CHEBI:230540) is a sulfamides (CHEBI:51871) |
| IUPAC Name |
|---|
| N-[(2R)-1,4-dioxan-2-ylmethyl]-N-methyl-N'-[3-(1-methyl-1H-pyrazol-4-yl)-5-oxo-5H-benzo[4,5]cyclohepta[1,2-b]pyridin-7-yl]sulfuric diamide |
| Synonyms | Source |
|---|---|
| 9-[[[(2R)-1,4-dioxan-2-yl]methyl-methylsulfamoyl]amino]-2-(1-methylpyrazol-4-yl)-11-oxobenzo[1,2]cyclohepta[2,4-b]pyridine | SUBMITTER |
| MK 2461 | ChEBI |
| MK2461 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:917879-39-1 | SUBMITTER |
| Citations |
|---|