EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO |
| Net Charge | 0 |
| Average Mass | 205.301 |
| Monoisotopic Mass | 205.14666 |
| SMILES | CCCCc1ccc(NC(C)=O)c(C)c1 |
| InChI | InChI=1S/C13H19NO/c1-4-5-6-12-7-8-13(10(2)9-12)14-11(3)15/h7-9H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | ZFVMECVBUGMWIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 6.3.2.19 (ubiquitin--protein ligase) inhibitor An enzyme inhibitor that interferes with the action of ubiquitin—protein ligase (EC 6.3.2.19). autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SMIP004 (CHEBI:230532) has role anticoronaviral agent (CHEBI:149553) |
| SMIP004 (CHEBI:230532) has role antidepressant (CHEBI:35469) |
| SMIP004 (CHEBI:230532) has role antineoplastic agent (CHEBI:35610) |
| SMIP004 (CHEBI:230532) has role apoptosis inducer (CHEBI:68495) |
| SMIP004 (CHEBI:230532) has role autophagy inducer (CHEBI:138880) |
| SMIP004 (CHEBI:230532) has role EC 6.3.2.19 (ubiquitin—protein ligase) inhibitor (CHEBI:75968) |
| SMIP004 (CHEBI:230532) is a N-benzylacetamides (CHEBI:51931) |
| SMIP004 (CHEBI:230532) is a alkylbenzene (CHEBI:38976) |
| SMIP004 (CHEBI:230532) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| N-(4-butyl-2-methylphenyl)acetamide |
| Synonyms | Source |
|---|---|
| SMIP-004 | ChEBI |
| SMIP 004 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:143360-00-3 | SUBMITTER |
| Citations |
|---|