EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO |
| Net Charge | 0 |
| Average Mass | 205.301 |
| Monoisotopic Mass | 205.14666 |
| SMILES | CCCCc1ccc(NC(C)=O)c(C)c1 |
| InChI | InChI=1S/C13H19NO/c1-4-5-6-12-7-8-13(10(2)9-12)14-11(3)15/h7-9H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | ZFVMECVBUGMWIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 6.3.2.19 (ubiquitin--protein ligase) inhibitor An enzyme inhibitor that interferes with the action of ubiquitin—protein ligase (EC 6.3.2.19). autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SMIP004 (CHEBI:230532) has role anticoronaviral agent (CHEBI:149553) |
| SMIP004 (CHEBI:230532) has role antidepressant (CHEBI:35469) |
| SMIP004 (CHEBI:230532) has role antineoplastic agent (CHEBI:35610) |
| SMIP004 (CHEBI:230532) has role apoptosis inducer (CHEBI:68495) |
| SMIP004 (CHEBI:230532) has role autophagy inducer (CHEBI:138880) |
| SMIP004 (CHEBI:230532) has role EC 6.3.2.19 (ubiquitin—protein ligase) inhibitor (CHEBI:75968) |
| SMIP004 (CHEBI:230532) is a N-benzylacetamides (CHEBI:51931) |
| SMIP004 (CHEBI:230532) is a alkylbenzene (CHEBI:38976) |
| SMIP004 (CHEBI:230532) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| N-(4-butyl-2-methylphenyl)acetamide |
| Synonyms | Source |
|---|---|
| SMIP 004 | ChEBI |
| SMIP-004 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:143360-00-3 | SUBMITTER |
| Citations |
|---|