EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9HF17O4 |
| Net Charge | 0 |
| Average Mass | 496.069 |
| Monoisotopic Mass | 495.96034 |
| SMILES | O=C(O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9HF17O4/c10-2(1(27)28,5(14,15)16)29-9(25,26)4(13,7(20,21)22)30-8(23,24)3(11,12)6(17,18)19/h(H,27,28) |
| InChIKey | OIVQVBDAMYDDEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexafluoropropylene oxide trimer acid (CHEBI:230529) has role apoptosis inducer (CHEBI:68495) |
| hexafluoropropylene oxide trimer acid (CHEBI:230529) has role cardiotoxic agent (CHEBI:50912) |
| hexafluoropropylene oxide trimer acid (CHEBI:230529) has role environmental contaminant (CHEBI:78298) |
| hexafluoropropylene oxide trimer acid (CHEBI:230529) has role hepatotoxic agent (CHEBI:50908) |
| hexafluoropropylene oxide trimer acid (CHEBI:230529) is a diether (CHEBI:46786) |
| hexafluoropropylene oxide trimer acid (CHEBI:230529) is a monocarboxylic acid (CHEBI:25384) |
| hexafluoropropylene oxide trimer acid (CHEBI:230529) is a polyfluoroalkyl substance (CHEBI:172406) |
| IUPAC Name |
|---|
| 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(heptafluoropropoxy)propoxy]propanoic acid |
| Synonyms | Source |
|---|---|
| 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-1-propanoic acid | ChEBI |
| 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoic acid | ChEBI |
| HFPO-TA | SUBMITTER |
| perfluoro-2,5-dimethyl-3,6-dioxa-nonanoic acid | ChEBI |
| perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid | SUBMITTER |
| X 70-540-3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:13252-14-7 | ChEBI |
| Citations |
|---|